About 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one
7-methyl-4-nitroindeno[2,1-b]pyridin-9-one (PubChem CID 59938912) has the molecular formula C13H8N2O3
and a molecular weight of 240.22 g/mol. Its IUPAC name is 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one.
Molecular Properties
| Compound Name | 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one |
| PubChem CID | 59938912 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one |
| SMILES | Cc1ccc2c(c1)C(=O)c1nccc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C13H8N2O3/c1-7-2-3-8-9(6-7)13(16)12-11(8)10(15(17)18)4-5-14-12/h2-6H,1H3 |
| InChIKey | BLNABHBRGCDBEU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one?
The IUPAC name of 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one (CID 59938912) is 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one.
What is the SMILES notation for 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one?
The canonical SMILES for 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one is Cc1ccc2c(c1)C(=O)c1nccc([N+](=O)[O-])c1-2.
What is the InChIKey of 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one?
The InChIKey is BLNABHBRGCDBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O3/c1-7-2-3-8-9(6-7)13(16)12-11(8)10(15(17)18)4-5-14-12/h2-6H,1H3.
What are the key properties of 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one?
7-methyl-4-nitroindeno[2,1-b]pyridin-9-one has a molecular weight of 240.22 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-nitroindeno[2,1-b]pyridin-9-one is sourced from PubChem (CID 59938912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).