About 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione
2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione (PubChem CID 141334324) has the molecular formula C17H7N3O6S
and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione.
Molecular Properties
| Compound Name | 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione |
| PubChem CID | 141334324 |
| Molecular Formula | C17H7N3O6S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione |
| SMILES | O=C1c2cc([N+](=O)[O-])sc2C(=O)c2c(-c3ccccc3[N+](=O)[O-])ccnc21 |
| InChI | InChI=1S/C17H7N3O6S/c21-15-10-7-12(20(25)26)27-17(10)16(22)13-9(5-6-18-14(13)15)8-3-1-2-4-11(8)19(23)24/h1-7H |
| InChIKey | YVONITICCAJSOD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 133.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione?
The IUPAC name of 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione (CID 141334324) is 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione.
What is the SMILES notation for 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione?
The canonical SMILES for 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione is O=C1c2cc([N+](=O)[O-])sc2C(=O)c2c(-c3ccccc3[N+](=O)[O-])ccnc21.
What is the InChIKey of 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione?
The InChIKey is YVONITICCAJSOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7N3O6S/c21-15-10-7-12(20(25)26)27-17(10)16(22)13-9(5-6-18-14(13)15)8-3-1-2-4-11(8)19(23)24/h1-7H.
What are the key properties of 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione?
2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione has a molecular weight of 381.33 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-8-(2-nitrophenyl)thieno[2,3-g]quinoline-4,9-dione is sourced from PubChem (CID 141334324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).