C14H8N2O6S — CID 141334316
ethyl 2-nitro-4,9-dioxothieno[2,3-g]quinoline-8-carboxylate (PubChem CID 141334316) has the molecular formula C14H8N2O6S and a molecular weight of 332.29 g/mol. Its IUPAC name is ethyl 2-nitro-4,9-dioxothieno[2,3-g]quinoline-8-carboxylate.
| Compound Name | ethyl 2-nitro-4,9-dioxothieno[2,3-g]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 141334316 |
| Molecular Formula | C14H8N2O6S |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | ethyl 2-nitro-4,9-dioxothieno[2,3-g]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccnc2c1C(=O)c1sc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C14H8N2O6S/c1-2-22-14(19)6-3-4-15-10-9(6)12(18)13-7(11(10)17)5-8(23-13)16(20)21/h3-5H,2H2,1H3 |
| InChIKey | ZUUCIQQJOGPPIC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 116.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|