C11H5NO4S2 — CID 20717954
7-methyl-2-nitrothieno[2,3-f][1]benzothiole-4,8-dione (PubChem CID 20717954) has the molecular formula C11H5NO4S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 7-methyl-2-nitrothieno[2,3-f][1]benzothiole-4,8-dione.
| Compound Name | 7-methyl-2-nitrothieno[2,3-f][1]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 20717954 |
| Molecular Formula | C11H5NO4S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 7-methyl-2-nitrothieno[2,3-f][1]benzothiole-4,8-dione |
| SMILES | Cc1csc2c1C(=O)c1sc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C11H5NO4S2/c1-4-3-17-11-7(4)9(14)10-5(8(11)13)2-6(18-10)12(15)16/h2-3H,1H3 |
| InChIKey | PEIZUWKEEBZLDS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|