C13H7N3O5 — CID 142655224
4-methoxy-9-nitropyrido[2,3-g]quinoline-5,10-dione (PubChem CID 142655224) has the molecular formula C13H7N3O5 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-methoxy-9-nitropyrido[2,3-g]quinoline-5,10-dione.
| Compound Name | 4-methoxy-9-nitropyrido[2,3-g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 142655224 |
| Molecular Formula | C13H7N3O5 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-methoxy-9-nitropyrido[2,3-g]quinoline-5,10-dione |
| SMILES | COc1ccnc2c1C(=O)c1nccc([N+](=O)[O-])c1C2=O |
| InChI | InChI=1S/C13H7N3O5/c1-21-7-3-5-15-11-9(7)13(18)10-8(12(11)17)6(16(19)20)2-4-14-10/h2-5H,1H3 |
| InChIKey | PLRJZGILEWFGPB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|