C23H21FN2O5 — CID 134936793
benzyl (2R)-2-[(2R,3S)-3-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbutanoate (PubChem CID 134936793) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is benzyl (2R)-2-[(2R,3S)-3-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbutanoate.
| Compound Name | benzyl (2R)-2-[(2R,3S)-3-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 134936793 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | benzyl (2R)-2-[(2R,3S)-3-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-oxoazetidin-1-yl]-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)OCc1ccccc1)N1C(=O)[C@H](N2C(=O)c3ccccc3C2=O)[C@H]1F |
| InChI | InChI=1S/C23H21FN2O5/c1-13(2)17(23(30)31-12-14-8-4-3-5-9-14)25-19(24)18(22(25)29)26-20(27)15-10-6-7-11-16(15)21(26)28/h3-11,13,17-19H,12H2,1-2H3/t17-,18-,19+/m1/s1 |
| InChIKey | ZZSYQWXZRHNXEW-QRVBRYPASA-N |
| XLogP | 2.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|