C17H42OS2Si4 — CID 134937869
[3,3-bis(methylsulfanyl)cyclohexyl]oxy-tris(trimethylsilyl)silane (PubChem CID 134937869) has the molecular formula C17H42OS2Si4 and a molecular weight of 439.00 g/mol. Its IUPAC name is [3,3-bis(methylsulfanyl)cyclohexyl]oxy-tris(trimethylsilyl)silane.
| Compound Name | [3,3-bis(methylsulfanyl)cyclohexyl]oxy-tris(trimethylsilyl)silane |
|---|---|
| PubChem CID | 134937869 |
| Molecular Formula | C17H42OS2Si4 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [3,3-bis(methylsulfanyl)cyclohexyl]oxy-tris(trimethylsilyl)silane |
| SMILES | CSC1(SC)CCCC(O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H42OS2Si4/c1-19-17(20-2)14-12-13-16(15-17)18-24(21(3,4)5,22(6,7)8)23(9,10)11/h16H,12-15H2,1-11H3 |
| InChIKey | FDYKKFNWCAUROD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|