C28H48O2S2 — CID 134938128
(4S,5S)-5-phenylmethoxy-1-(2-propan-2-yl-1,3-dithiolan-2-yl)pentadecan-4-ol (PubChem CID 134938128) has the molecular formula C28H48O2S2 and a molecular weight of 480.82 g/mol. Its IUPAC name is (4S,5S)-5-phenylmethoxy-1-(2-propan-2-yl-1,3-dithiolan-2-yl)pentadecan-4-ol.
| Compound Name | (4S,5S)-5-phenylmethoxy-1-(2-propan-2-yl-1,3-dithiolan-2-yl)pentadecan-4-ol |
|---|---|
| PubChem CID | 134938128 |
| Molecular Formula | C28H48O2S2 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (4S,5S)-5-phenylmethoxy-1-(2-propan-2-yl-1,3-dithiolan-2-yl)pentadecan-4-ol |
| SMILES | CCCCCCCCCC[C@H](OCc1ccccc1)[C@@H](O)CCCC1(C(C)C)SCCS1 |
| InChI | InChI=1S/C28H48O2S2/c1-4-5-6-7-8-9-10-14-19-27(30-23-25-16-12-11-13-17-25)26(29)18-15-20-28(24(2)3)31-21-22-32-28/h11-13,16-17,24,26-27,29H,4-10,14-15,18-23H2,1-3H3/t26-,27-/m0/s1 |
| InChIKey | OGXZPSJAYCAGQG-SVBPBHIXSA-N |
| XLogP | 8.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|