C30H54O6Si — CID 134939081
(1S,6S,9R,13R,14S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-6,13,19-trimethyl-9-propyl-8,20-dioxabicyclo[15.2.1]icosane-7,11,15-trione (PubChem CID 134939081) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is (1S,6S,9R,13R,14S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-6,13,19-trimethyl-9-propyl-8,20-dioxabicyclo[15.2.1]icosane-7,11,15-trione.
| Compound Name | (1S,6S,9R,13R,14S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-6,13,19-trimethyl-9-propyl-8,20-dioxabicyclo[15.2.1]icosane-7,11,15-trione |
|---|---|
| PubChem CID | 134939081 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (1S,6S,9R,13R,14S,17R,19S)-14-[tert-butyl(dimethyl)silyl]oxy-6,13,19-trimethyl-9-propyl-8,20-dioxabicyclo[15.2.1]icosane-7,11,15-trione |
| SMILES | CCC[C@@H]1CC(=O)C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)C[C@H]2C[C@H](C)[C@H](CCCC[C@H](C)C(=O)O1)O2 |
| InChI | InChI=1S/C30H54O6Si/c1-10-13-24-18-23(31)16-22(4)28(36-37(8,9)30(5,6)7)26(32)19-25-17-21(3)27(34-25)15-12-11-14-20(2)29(33)35-24/h20-22,24-25,27-28H,10-19H2,1-9H3/t20-,21-,22+,24+,25+,27-,28-/m0/s1 |
| InChIKey | DONGTVPVQNAYQF-CUVCNJFMSA-N |
| XLogP | 7.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|