C20H40O4Si — CID 70021597
methyl 9-[tert-butyl(dimethyl)silyl]oxy-2-(oxolan-2-yl)nonanoate (PubChem CID 70021597) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is methyl 9-[tert-butyl(dimethyl)silyl]oxy-2-(oxolan-2-yl)nonanoate.
| Compound Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-2-(oxolan-2-yl)nonanoate |
|---|---|
| PubChem CID | 70021597 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-2-(oxolan-2-yl)nonanoate |
| SMILES | COC(=O)C(CCCCCCCO[Si](C)(C)C(C)(C)C)C1CCCO1 |
| InChI | InChI=1S/C20H40O4Si/c1-20(2,3)25(5,6)24-16-11-9-7-8-10-13-17(19(21)22-4)18-14-12-15-23-18/h17-18H,7-16H2,1-6H3 |
| InChIKey | DCHPGKWIAJWBBN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|