C31H62O4SiSn — CID 14297154
methyl 7-[(1S,2R,3R)-5-oxo-2-tributylstannyl-3-triethylsilyloxycyclopentyl]heptanoate (PubChem CID 14297154) has the molecular formula C31H62O4SiSn and a molecular weight of 645.63 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R)-5-oxo-2-tributylstannyl-3-triethylsilyloxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2R,3R)-5-oxo-2-tributylstannyl-3-triethylsilyloxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 14297154 |
| Molecular Formula | C31H62O4SiSn |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | methyl 7-[(1S,2R,3R)-5-oxo-2-tributylstannyl-3-triethylsilyloxycyclopentyl]heptanoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H]1[C@H](O[Si](CC)(CC)CC)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H35O4Si.3C4H9.Sn/c1-5-24(6-2,7-3)23-17-14-16(18(20)15-17)12-10-8-9-11-13-19(21)22-4;3*1-3-4-2;/h14,16-17H,5-13,15H2,1-4H3;3*1,3-4H2,2H3;/t16-,17+;;;;/m1..../s1 |
| InChIKey | BSPVIZKXDWJYGM-PNNYBRIFSA-N |
| XLogP | 9.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|