C20H40O4Si — CID 131749866
[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxooctyl] 2,2-dimethylpropanoate (PubChem CID 131749866) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxooctyl] 2,2-dimethylpropanoate.
| Compound Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxooctyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 131749866 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-7-oxooctyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)C(C)C[C@@H](CCCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-15(16(2)21)14-17(24-25(9,10)20(6,7)8)12-11-13-23-18(22)19(3,4)5/h15,17H,11-14H2,1-10H3/t15?,17-/m1/s1 |
| InChIKey | HHANGMWYLDUIJT-OMOCHNIRSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|