C17H16N2O4 — CID 134939731
[2-hydroxy-3-(1,10-phenanthrolin-5-yloxy)propyl] acetate (PubChem CID 134939731) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is [2-hydroxy-3-(1,10-phenanthrolin-5-yloxy)propyl] acetate.
| Compound Name | [2-hydroxy-3-(1,10-phenanthrolin-5-yloxy)propyl] acetate |
|---|---|
| PubChem CID | 134939731 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-hydroxy-3-(1,10-phenanthrolin-5-yloxy)propyl] acetate |
| SMILES | CC(=O)OCC(O)COc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C17H16N2O4/c1-11(20)22-9-13(21)10-23-15-8-12-4-2-6-18-16(12)17-14(15)5-3-7-19-17/h2-8,13,21H,9-10H2,1H3 |
| InChIKey | XFFYLWXVUZWOMJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|