C27H39N3O6Si — CID 155602694
8-(1,10-phenanthrolin-5-yloxy)octyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 155602694) has the molecular formula C27H39N3O6Si and a molecular weight of 529.71 g/mol. Its IUPAC name is 8-(1,10-phenanthrolin-5-yloxy)octyl N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | 8-(1,10-phenanthrolin-5-yloxy)octyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 155602694 |
| Molecular Formula | C27H39N3O6Si |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 8-(1,10-phenanthrolin-5-yloxy)octyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCNC(=O)OCCCCCCCCOc1cc2cccnc2c2ncccc12)(OC)OC |
| InChI | InChI=1S/C27H39N3O6Si/c1-32-37(33-2,34-3)20-12-17-30-27(31)36-19-9-7-5-4-6-8-18-35-24-21-22-13-10-15-28-25(22)26-23(24)14-11-16-29-26/h10-11,13-16,21H,4-9,12,17-20H2,1-3H3,(H,30,31) |
| InChIKey | YKBVTVOSYNRDGR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|