C21H28N4O4SSi — CID 155602705
1-[2-(1,10-phenanthrolin-5-ylsulfanyl)ethyl]-3-(3-trimethoxysilylpropyl)urea (PubChem CID 155602705) has the molecular formula C21H28N4O4SSi and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-[2-(1,10-phenanthrolin-5-ylsulfanyl)ethyl]-3-(3-trimethoxysilylpropyl)urea.
| Compound Name | 1-[2-(1,10-phenanthrolin-5-ylsulfanyl)ethyl]-3-(3-trimethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 155602705 |
| Molecular Formula | C21H28N4O4SSi |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-[2-(1,10-phenanthrolin-5-ylsulfanyl)ethyl]-3-(3-trimethoxysilylpropyl)urea |
| SMILES | CO[Si](CCCNC(=O)NCCSc1cc2cccnc2c2ncccc12)(OC)OC |
| InChI | InChI=1S/C21H28N4O4SSi/c1-27-31(28-2,29-3)14-6-11-24-21(26)25-12-13-30-18-15-16-7-4-9-22-19(16)20-17(18)8-5-10-23-20/h4-5,7-10,15H,6,11-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | NVQXNTWDISHHCV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|