C25H35N3O2S — CID 142565649
butyl N-[8-(1,10-phenanthrolin-5-ylsulfanyl)octyl]carbamate;molecular hydrogen (PubChem CID 142565649) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is butyl N-[8-(1,10-phenanthrolin-5-ylsulfanyl)octyl]carbamate;molecular hydrogen.
| Compound Name | butyl N-[8-(1,10-phenanthrolin-5-ylsulfanyl)octyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 142565649 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | butyl N-[8-(1,10-phenanthrolin-5-ylsulfanyl)octyl]carbamate;molecular hydrogen |
| SMILES | CCCCOC(=O)NCCCCCCCCSc1cc2cccnc2c2ncccc12.[H][H] |
| InChI | InChI=1S/C25H33N3O2S.H2/c1-2-3-17-30-25(29)28-14-8-6-4-5-7-9-18-31-22-19-20-12-10-15-26-23(20)24-21(22)13-11-16-27-24;/h10-13,15-16,19H,2-9,14,17-18H2,1H3,(H,28,29);1H |
| InChIKey | KFCNJHYGFXSQJI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|