C27H39N3O5SSi — CID 155602685
8-(1,10-phenanthrolin-5-ylsulfanyl)octyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 155602685) has the molecular formula C27H39N3O5SSi and a molecular weight of 545.78 g/mol. Its IUPAC name is 8-(1,10-phenanthrolin-5-ylsulfanyl)octyl N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | 8-(1,10-phenanthrolin-5-ylsulfanyl)octyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 155602685 |
| Molecular Formula | C27H39N3O5SSi |
| Molecular Weight | 545.78 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 8-(1,10-phenanthrolin-5-ylsulfanyl)octyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCNC(=O)OCCCCCCCCSc1cc2cccnc2c2ncccc12)(OC)OC |
| InChI | InChI=1S/C27H39N3O5SSi/c1-32-37(33-2,34-3)20-12-17-30-27(31)35-18-8-6-4-5-7-9-19-36-24-21-22-13-10-15-28-25(22)26-23(24)14-11-16-29-26/h10-11,13-16,21H,4-9,12,17-20H2,1-3H3,(H,30,31) |
| InChIKey | WAYXZYMXXZGIEO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|