C25H40N4O7Si — CID 102265538
2-[2-[[2-oxo-2-(quinolin-8-ylamino)ethyl]amino]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 102265538) has the molecular formula C25H40N4O7Si and a molecular weight of 536.70 g/mol. Its IUPAC name is 2-[2-[[2-oxo-2-(quinolin-8-ylamino)ethyl]amino]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[2-[[2-oxo-2-(quinolin-8-ylamino)ethyl]amino]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 102265538 |
| Molecular Formula | C25H40N4O7Si |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[2-[[2-oxo-2-(quinolin-8-ylamino)ethyl]amino]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCOCCNCC(=O)Nc1cccc2cccnc12)(OCC)OCC |
| InChI | InChI=1S/C25H40N4O7Si/c1-4-34-37(35-5-2,36-6-3)19-9-14-28-25(31)33-18-17-32-16-15-26-20-23(30)29-22-12-7-10-21-11-8-13-27-24(21)22/h7-8,10-13,26H,4-6,9,14-20H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | OCEIJXSGGZDUCI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|