C28H39N2O4Si+ — CID 134940129
(1R,2S,3R,4R)-4-[[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]methyl]-3-methyl-2-nitrocyclohexan-1-ol (PubChem CID 134940129) has the molecular formula C28H39N2O4Si+ and a molecular weight of 495.72 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4-[[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]methyl]-3-methyl-2-nitrocyclohexan-1-ol.
| Compound Name | (1R,2S,3R,4R)-4-[[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]methyl]-3-methyl-2-nitrocyclohexan-1-ol |
|---|---|
| PubChem CID | 134940129 |
| Molecular Formula | C28H39N2O4Si+ |
| Molecular Weight | 495.72 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (1R,2S,3R,4R)-4-[[(2S)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-ium-1-ylidene]methyl]-3-methyl-2-nitrocyclohexan-1-ol |
| SMILES | C[C@H]1[C@H]([N+](=O)[O-])[C@H](O)CC[C@H]1/C=[N+]1\CCC[C@H]1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39N2O4Si/c1-21-22(17-18-25(31)27(21)30(32)33)20-29-19-11-16-26(29)28(34-35(2,3)4,23-12-7-5-8-13-23)24-14-9-6-10-15-24/h5-10,12-15,20-22,25-27,31H,11,16-19H2,1-4H3/q+1/b29-20+/t21-,22+,25-,26+,27+/m1/s1 |
| InChIKey | KJDGYDKHGJEUNM-POHBYLGGSA-N |
| XLogP | 5.08 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|