C33H39N3O6 — CID 134940263
tert-butyl (2S,4R,6R)-2-(4-methylphenyl)-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 134940263) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is tert-butyl (2S,4R,6R)-2-(4-methylphenyl)-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R,6R)-2-(4-methylphenyl)-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134940263 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | tert-butyl (2S,4R,6R)-2-(4-methylphenyl)-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | Cc1ccc([C@@H]2C[C@@H](NC(=O)OCc3ccccc3)C[C@H](NC(=O)OCc3ccccc3)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H39N3O6/c1-23-15-17-26(18-16-23)28-19-27(34-30(37)40-21-24-11-7-5-8-12-24)20-29(36(28)32(39)42-33(2,3)4)35-31(38)41-22-25-13-9-6-10-14-25/h5-18,27-29H,19-22H2,1-4H3,(H,34,37)(H,35,38)/t27-,28+,29-/m1/s1 |
| InChIKey | JRLDHSDSQBMYHO-SSBOKUKZSA-N |
| XLogP | 6.61 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|