C34H39N3O6 — CID 23629425
tert-butyl (2S,4R,6R)-2-[(E)-2-phenylethenyl]-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 23629425) has the molecular formula C34H39N3O6 and a molecular weight of 585.70 g/mol. Its IUPAC name is tert-butyl (2S,4R,6R)-2-[(E)-2-phenylethenyl]-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R,6R)-2-[(E)-2-phenylethenyl]-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23629425 |
| Molecular Formula | C34H39N3O6 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | tert-butyl (2S,4R,6R)-2-[(E)-2-phenylethenyl]-4,6-bis(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/c2ccccc2)C[C@@H](NC(=O)OCc2ccccc2)C[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H39N3O6/c1-34(2,3)43-33(40)37-29(20-19-25-13-7-4-8-14-25)21-28(35-31(38)41-23-26-15-9-5-10-16-26)22-30(37)36-32(39)42-24-27-17-11-6-12-18-27/h4-20,28-30H,21-24H2,1-3H3,(H,35,38)(H,36,39)/b20-19+/t28-,29-,30-/m1/s1 |
| InChIKey | QEJVLBJXJHCPSJ-RRXIQXEMSA-N |
| XLogP | 6.65 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|