C21H25F3O5S — CID 134940779
[(3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]butyl] benzoate (PubChem CID 134940779) has the molecular formula C21H25F3O5S and a molecular weight of 446.49 g/mol. Its IUPAC name is [(3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]butyl] benzoate.
| Compound Name | [(3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]butyl] benzoate |
|---|---|
| PubChem CID | 134940779 |
| Molecular Formula | C21H25F3O5S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [(3R)-3-[(1S,4R)-4-ethenyl-1-methyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]butyl] benzoate |
| SMILES | C=C[C@@H]1C=C(OS(=O)(=O)C(F)(F)F)[C@](C)([C@H](C)CCOC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25F3O5S/c1-4-16-10-12-20(3,18(14-16)29-30(26,27)21(22,23)24)15(2)11-13-28-19(25)17-8-6-5-7-9-17/h4-9,14-16H,1,10-13H2,2-3H3/t15-,16+,20+/m1/s1 |
| InChIKey | ZPQIAPBTHHJDGF-GUXCAODWSA-N |
| XLogP | 5.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|