C19H23NO2 — CID 134940817
methyl (2R,3S)-3-(2,5-dimethylanilino)-2-methyl-3-phenylpropanoate (PubChem CID 134940817) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl (2R,3S)-3-(2,5-dimethylanilino)-2-methyl-3-phenylpropanoate.
| Compound Name | methyl (2R,3S)-3-(2,5-dimethylanilino)-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 134940817 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | methyl (2R,3S)-3-(2,5-dimethylanilino)-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](C)[C@H](Nc1cc(C)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-13-10-11-14(2)17(12-13)20-18(15(3)19(21)22-4)16-8-6-5-7-9-16/h5-12,15,18,20H,1-4H3/t15-,18+/m1/s1 |
| InChIKey | PZIROGFUOUSZOA-QAPCUYQASA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |