C17H22NO3P — CID 3093271
N-[dimethoxyphosphoryl(phenyl)methyl]-2,5-dimethylaniline (PubChem CID 3093271) has the molecular formula C17H22NO3P and a molecular weight of 319.34 g/mol. Its IUPAC name is N-[dimethoxyphosphoryl(phenyl)methyl]-2,5-dimethylaniline.
| Compound Name | N-[dimethoxyphosphoryl(phenyl)methyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 3093271 |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[dimethoxyphosphoryl(phenyl)methyl]-2,5-dimethylaniline |
| SMILES | COP(=O)(OC)C(Nc1cc(C)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C17H22NO3P/c1-13-10-11-14(2)16(12-13)18-17(22(19,20-3)21-4)15-8-6-5-7-9-15/h5-12,17-18H,1-4H3 |
| InChIKey | RNSUQKNCYFOJJT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|