C15H26NO3P — CID 50924024
(2S)-N-[(S)-dimethoxyphosphoryl(phenyl)methyl]-3,3-dimethylbutan-2-amine (PubChem CID 50924024) has the molecular formula C15H26NO3P and a molecular weight of 299.35 g/mol. Its IUPAC name is (2S)-N-[(S)-dimethoxyphosphoryl(phenyl)methyl]-3,3-dimethylbutan-2-amine.
| Compound Name | (2S)-N-[(S)-dimethoxyphosphoryl(phenyl)methyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 50924024 |
| Molecular Formula | C15H26NO3P |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2S)-N-[(S)-dimethoxyphosphoryl(phenyl)methyl]-3,3-dimethylbutan-2-amine |
| SMILES | COP(=O)(OC)[C@H](N[C@@H](C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H26NO3P/c1-12(15(2,3)4)16-14(20(17,18-5)19-6)13-10-8-7-9-11-13/h7-12,14,16H,1-6H3/t12-,14-/m0/s1 |
| InChIKey | VJWCLDZVIBMPHM-JSGCOSHPSA-N |
| XLogP | 4.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|