C11H15NO — CID 134940899
N,N-dimethylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide (PubChem CID 134940899) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N,N-dimethylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide.
| Compound Name | N,N-dimethylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
|---|---|
| PubChem CID | 134940899 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N,N-dimethylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
| SMILES | CN(C)C(=O)C1=CC2C=CC1CC2 |
| InChI | InChI=1S/C11H15NO/c1-12(2)11(13)10-7-8-3-5-9(10)6-4-8/h3,5,7-9H,4,6H2,1-2H3 |
| InChIKey | BJPPRSGWIRDQER-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|