About (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane
(5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane (PubChem CID 134941112) has the molecular formula C25H26N2O
and a molecular weight of 370.50 g/mol. Its IUPAC name is (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane.
Molecular Properties
| Compound Name | (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane |
| PubChem CID | 134941112 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane |
| SMILES | CCC12CN3CCC1CC3[C@H](c1ccnc3ccc(-c4ccccc4)cc13)O2 |
| InChI | InChI=1S/C25H26N2O/c1-2-25-16-27-13-11-19(25)15-23(27)24(28-25)20-10-12-26-22-9-8-18(14-21(20)22)17-6-4-3-5-7-17/h3-10,12,14,19,23-24H,2,11,13,15-16H2,1H3/t19?,23?,24-,25?/m0/s1 |
| InChIKey | HVWFLQBEYHRBOJ-KIGUFTPJSA-N |
| XLogP | 5.22 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane?
The IUPAC name of (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane (CID 134941112) is (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane.
What is the SMILES notation for (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane?
The canonical SMILES for (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane is CCC12CN3CCC1CC3[C@H](c1ccnc3ccc(-c4ccccc4)cc13)O2.
What is the InChIKey of (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane?
The InChIKey is HVWFLQBEYHRBOJ-KIGUFTPJSA-N. The full InChI is InChI=1S/C25H26N2O/c1-2-25-16-27-13-11-19(25)15-23(27)24(28-25)20-10-12-26-22-9-8-18(14-21(20)22)17-6-4-3-5-7-17/h3-10,12,14,19,23-24H,2,11,13,15-16H2,1H3/t19?,23?,24-,25?/m0/s1.
What are the key properties of (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane?
(5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane has a molecular weight of 370.50 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3-ethyl-5-(6-phenylquinolin-4-yl)-4-oxa-1-azatricyclo[4.4.0.03,8]decane is sourced from PubChem (CID 134941112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).