C16H18F3NO2 — CID 134942194
[(2S,3S)-2-phenyl-1-prop-2-enylpiperidin-3-yl] 2,2,2-trifluoroacetate (PubChem CID 134942194) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is [(2S,3S)-2-phenyl-1-prop-2-enylpiperidin-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S)-2-phenyl-1-prop-2-enylpiperidin-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134942194 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [(2S,3S)-2-phenyl-1-prop-2-enylpiperidin-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CCN1CCC[C@H](OC(=O)C(F)(F)F)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18F3NO2/c1-2-10-20-11-6-9-13(22-15(21)16(17,18)19)14(20)12-7-4-3-5-8-12/h2-5,7-8,13-14H,1,6,9-11H2/t13-,14-/m0/s1 |
| InChIKey | KCCZDRXDBZGTTO-KBPBESRZSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|