C32H43N3O9 — CID 134942745
N-ethyl-2,6-bis[4-(4-formyl-3-methoxyphenoxy)butanoylamino]hexanamide (PubChem CID 134942745) has the molecular formula C32H43N3O9 and a molecular weight of 613.71 g/mol. Its IUPAC name is N-ethyl-2,6-bis[4-(4-formyl-3-methoxyphenoxy)butanoylamino]hexanamide.
| Compound Name | N-ethyl-2,6-bis[4-(4-formyl-3-methoxyphenoxy)butanoylamino]hexanamide |
|---|---|
| PubChem CID | 134942745 |
| Molecular Formula | C32H43N3O9 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | N-ethyl-2,6-bis[4-(4-formyl-3-methoxyphenoxy)butanoylamino]hexanamide |
| SMILES | CCNC(=O)C(CCCCNC(=O)CCCOc1ccc(C=O)c(OC)c1)NC(=O)CCCOc1ccc(C=O)c(OC)c1 |
| InChI | InChI=1S/C32H43N3O9/c1-4-33-32(40)27(35-31(39)11-8-18-44-26-15-13-24(22-37)29(20-26)42-3)9-5-6-16-34-30(38)10-7-17-43-25-14-12-23(21-36)28(19-25)41-2/h12-15,19-22,27H,4-11,16-18H2,1-3H3,(H,33,40)(H,34,38)(H,35,39) |
| InChIKey | BPBYQNKSKHMDOH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|