C18H20O — CID 134942800
(1S)-1-[(1S,2S)-2-(4-methylphenyl)-3-phenylcyclopropyl]ethanol (PubChem CID 134942800) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (1S)-1-[(1S,2S)-2-(4-methylphenyl)-3-phenylcyclopropyl]ethanol.
| Compound Name | (1S)-1-[(1S,2S)-2-(4-methylphenyl)-3-phenylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 134942800 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1S)-1-[(1S,2S)-2-(4-methylphenyl)-3-phenylcyclopropyl]ethanol |
| SMILES | Cc1ccc([C@H]2C(c3ccccc3)[C@@H]2[C@H](C)O)cc1 |
| InChI | InChI=1S/C18H20O/c1-12-8-10-15(11-9-12)18-16(13(2)19)17(18)14-6-4-3-5-7-14/h3-11,13,16-19H,1-2H3/t13-,16-,17?,18+/m0/s1 |
| InChIKey | FVBFIKSEAYRPJF-JCTARUDMSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |