C18H30O6 — CID 134943509
[(E,3R)-9-ethoxycarbonyloxy-3-hydroxy-5-methylidenenon-7-enyl] 2,2-dimethylpropanoate (PubChem CID 134943509) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(E,3R)-9-ethoxycarbonyloxy-3-hydroxy-5-methylidenenon-7-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R)-9-ethoxycarbonyloxy-3-hydroxy-5-methylidenenon-7-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134943509 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(E,3R)-9-ethoxycarbonyloxy-3-hydroxy-5-methylidenenon-7-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C/C=C/COC(=O)OCC)C[C@@H](O)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H30O6/c1-6-22-17(21)24-11-8-7-9-14(2)13-15(19)10-12-23-16(20)18(3,4)5/h7-8,15,19H,2,6,9-13H2,1,3-5H3/b8-7+/t15-/m0/s1 |
| InChIKey | LGWYGVXBVBUCKA-KIUWMYQTSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|