C17H26O4 — CID 123337353
tert-butyl (3-hexa-2,4-dien-3-yl-5-hydroxycyclohex-2-en-1-yl) carbonate (PubChem CID 123337353) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is tert-butyl (3-hexa-2,4-dien-3-yl-5-hydroxycyclohex-2-en-1-yl) carbonate.
| Compound Name | tert-butyl (3-hexa-2,4-dien-3-yl-5-hydroxycyclohex-2-en-1-yl) carbonate |
|---|---|
| PubChem CID | 123337353 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl (3-hexa-2,4-dien-3-yl-5-hydroxycyclohex-2-en-1-yl) carbonate |
| SMILES | CC=CC(=CC)C1=CC(OC(=O)OC(C)(C)C)CC(O)C1 |
| InChI | InChI=1S/C17H26O4/c1-6-8-12(7-2)13-9-14(18)11-15(10-13)20-16(19)21-17(3,4)5/h6-8,10,14-15,18H,9,11H2,1-5H3 |
| InChIKey | LSMOOEKYVPNDPP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|