C14H26O6 — CID 139210700
[(E,5S,6R)-6,7-dihydroxy-5-(methoxymethoxy)hept-2-enyl] 2,2-dimethylpropanoate (PubChem CID 139210700) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(E,5S,6R)-6,7-dihydroxy-5-(methoxymethoxy)hept-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,5S,6R)-6,7-dihydroxy-5-(methoxymethoxy)hept-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139210700 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [(E,5S,6R)-6,7-dihydroxy-5-(methoxymethoxy)hept-2-enyl] 2,2-dimethylpropanoate |
| SMILES | COCO[C@@H](C/C=C/COC(=O)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C14H26O6/c1-14(2,3)13(17)19-8-6-5-7-12(11(16)9-15)20-10-18-4/h5-6,11-12,15-16H,7-10H2,1-4H3/b6-5+/t11-,12+/m1/s1 |
| InChIKey | URKDTLLCKFWRRC-AIIUZBJTSA-N |
| XLogP | 0.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|