C12H19IO5 — CID 135006111
(3-hydroxy-4-iodo-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl 2,2-dimethylpropanoate (PubChem CID 135006111) has the molecular formula C12H19IO5 and a molecular weight of 370.18 g/mol. Its IUPAC name is (3-hydroxy-4-iodo-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (3-hydroxy-4-iodo-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135006111 |
| Molecular Formula | C12H19IO5 |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (3-hydroxy-4-iodo-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl 2,2-dimethylpropanoate |
| SMILES | COC1C=C(I)C(O)C(COC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H19IO5/c1-12(2,3)11(15)17-6-8-10(14)7(13)5-9(16-4)18-8/h5,8-10,14H,6H2,1-4H3 |
| InChIKey | XDNPKTABHSIZGQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|