C12H17IO6 — CID 146164569
(3-acetyloxy-6-ethoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 146164569) has the molecular formula C12H17IO6 and a molecular weight of 384.17 g/mol. Its IUPAC name is (3-acetyloxy-6-ethoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-6-ethoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 146164569 |
| Molecular Formula | C12H17IO6 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (3-acetyloxy-6-ethoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CCOC1OC(COC(C)=O)C(OC(C)=O)C=C1I |
| InChI | InChI=1S/C12H17IO6/c1-4-16-12-9(13)5-10(18-8(3)15)11(19-12)6-17-7(2)14/h5,10-12H,4,6H2,1-3H3 |
| InChIKey | DTEPCMTUMKPJRA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|