C14H21IO6 — CID 146164570
(3-acetyloxy-6-butoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 146164570) has the molecular formula C14H21IO6 and a molecular weight of 412.22 g/mol. Its IUPAC name is (3-acetyloxy-6-butoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-6-butoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 146164570 |
| Molecular Formula | C14H21IO6 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (3-acetyloxy-6-butoxy-5-iodo-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CCCCOC1OC(COC(C)=O)C(OC(C)=O)C=C1I |
| InChI | InChI=1S/C14H21IO6/c1-4-5-6-18-14-11(15)7-12(20-10(3)17)13(21-14)8-19-9(2)16/h7,12-14H,4-6,8H2,1-3H3 |
| InChIKey | DRBIUXFDGCLWGP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|