C11H16NO2- — CID 134943539
(2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate (PubChem CID 134943539) has the molecular formula C11H16NO2- and a molecular weight of 194.25 g/mol. Its IUPAC name is (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate.
| Compound Name | (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134943539 |
| Molecular Formula | C11H16NO2- |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (2S)-1-(cyclohexen-1-yl)pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCN1C1=CCCCC1 |
| InChI | InChI=1S/C11H17NO2/c13-11(14)10-7-4-8-12(10)9-5-2-1-3-6-9/h5,10H,1-4,6-8H2,(H,13,14)/p-1/t10-/m0/s1 |
| InChIKey | FGOQJKISPWOYSX-JTQLQIEISA-M |
| XLogP | 0.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |