C22H24N2O — CID 134944208
(5S)-1-benzyl-5-(2,3,5-trimethylindol-1-yl)pyrrolidin-2-one (PubChem CID 134944208) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (5S)-1-benzyl-5-(2,3,5-trimethylindol-1-yl)pyrrolidin-2-one.
| Compound Name | (5S)-1-benzyl-5-(2,3,5-trimethylindol-1-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134944208 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (5S)-1-benzyl-5-(2,3,5-trimethylindol-1-yl)pyrrolidin-2-one |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2[C@@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O/c1-15-9-10-20-19(13-15)16(2)17(3)24(20)21-11-12-22(25)23(21)14-18-7-5-4-6-8-18/h4-10,13,21H,11-12,14H2,1-3H3/t21-/m1/s1 |
| InChIKey | BKHCWUKXGKPDRY-OAQYLSRUSA-N |
| XLogP | 4.89 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |