About (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one
(5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one (PubChem CID 139258811) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one |
| PubChem CID | 139258811 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one |
| SMILES | Cc1cn([C@@H]2CCC(=O)N2Cc2ccccc2)c2c(C)cccc12 |
| InChI | InChI=1S/C21H22N2O/c1-15-7-6-10-18-16(2)13-23(21(15)18)19-11-12-20(24)22(19)14-17-8-4-3-5-9-17/h3-10,13,19H,11-12,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | HOFVPAQZXZSTRI-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one?
The IUPAC name of (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one (CID 139258811) is (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one.
What is the SMILES notation for (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one?
The canonical SMILES for (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one is Cc1cn([C@@H]2CCC(=O)N2Cc2ccccc2)c2c(C)cccc12.
What is the InChIKey of (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one?
The InChIKey is HOFVPAQZXZSTRI-LJQANCHMSA-N. The full InChI is InChI=1S/C21H22N2O/c1-15-7-6-10-18-16(2)13-23(21(15)18)19-11-12-20(24)22(19)14-17-8-4-3-5-9-17/h3-10,13,19H,11-12,14H2,1-2H3/t19-/m1/s1.
What are the key properties of (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one?
(5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one has a molecular weight of 318.42 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-benzyl-5-(3,7-dimethylindol-1-yl)pyrrolidin-2-one is sourced from PubChem (CID 139258811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).