C24H31F3OSi2 — CID 134944942
[(1E,3E)-4-[dimethyl(2,2,2-trifluoroethoxy)silyl]-2,3-diphenylpenta-1,3-dienyl]-trimethylsilane (PubChem CID 134944942) has the molecular formula C24H31F3OSi2 and a molecular weight of 448.68 g/mol. Its IUPAC name is [(1E,3E)-4-[dimethyl(2,2,2-trifluoroethoxy)silyl]-2,3-diphenylpenta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E,3E)-4-[dimethyl(2,2,2-trifluoroethoxy)silyl]-2,3-diphenylpenta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 134944942 |
| Molecular Formula | C24H31F3OSi2 |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [(1E,3E)-4-[dimethyl(2,2,2-trifluoroethoxy)silyl]-2,3-diphenylpenta-1,3-dienyl]-trimethylsilane |
| SMILES | C/C(=C(C(=C\[Si](C)(C)C)\c1ccccc1)/c1ccccc1)[Si](C)(C)OCC(F)(F)F |
| InChI | InChI=1S/C24H31F3OSi2/c1-19(30(5,6)28-18-24(25,26)27)23(21-15-11-8-12-16-21)22(17-29(2,3)4)20-13-9-7-10-14-20/h7-17H,18H2,1-6H3/b22-17+,23-19+ |
| InChIKey | LUEJQYRPGWTPIT-MBIFUTBRSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|