C19H18F3N3O4 — CID 134945627
benzyl N-[2-oxo-2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]ethyl]carbamate (PubChem CID 134945627) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134945627 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | benzyl N-[2-oxo-2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]ethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N3O4/c20-19(21,22)14-7-4-8-15(9-14)25-17(27)11-23-16(26)10-24-18(28)29-12-13-5-2-1-3-6-13/h1-9H,10-12H2,(H,23,26)(H,24,28)(H,25,27) |
| InChIKey | VKZPCBIKQVLRFO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |