C23H18N2O2 — CID 134945763
[(3S)-2-benzoyl-5-phenyl-3,4-dihydropyrazol-3-yl]-phenylmethanone (PubChem CID 134945763) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(3S)-2-benzoyl-5-phenyl-3,4-dihydropyrazol-3-yl]-phenylmethanone.
| Compound Name | [(3S)-2-benzoyl-5-phenyl-3,4-dihydropyrazol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134945763 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(3S)-2-benzoyl-5-phenyl-3,4-dihydropyrazol-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CC(c2ccccc2)=NN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2/c26-22(18-12-6-2-7-13-18)21-16-20(17-10-4-1-5-11-17)24-25(21)23(27)19-14-8-3-9-15-19/h1-15,21H,16H2/t21-/m0/s1 |
| InChIKey | VEOGVFXYHYASAB-NRFANRHFSA-N |
| XLogP | 4.19 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |