C13H9NO4 — CID 134946221
5-(4-nitrophenyl)-1,3-benzodioxole (PubChem CID 134946221) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-1,3-benzodioxole.
| Compound Name | 5-(4-nitrophenyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 134946221 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(4-nitrophenyl)-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C13H9NO4/c15-14(16)11-4-1-9(2-5-11)10-3-6-12-13(7-10)18-8-17-12/h1-7H,8H2 |
| InChIKey | JOOABHBYPROPMW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|