C13H10F2N2O4S — CID 11348021
2,2-difluoro-5-[4-(sulfamoylamino)phenyl]-1,3-benzodioxole (PubChem CID 11348021) has the molecular formula C13H10F2N2O4S and a molecular weight of 328.30 g/mol. Its IUPAC name is 2,2-difluoro-5-[4-(sulfamoylamino)phenyl]-1,3-benzodioxole.
| Compound Name | 2,2-difluoro-5-[4-(sulfamoylamino)phenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 11348021 |
| Molecular Formula | C13H10F2N2O4S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2,2-difluoro-5-[4-(sulfamoylamino)phenyl]-1,3-benzodioxole |
| SMILES | NS(=O)(=O)Nc1ccc(-c2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C13H10F2N2O4S/c14-13(15)20-11-6-3-9(7-12(11)21-13)8-1-4-10(5-2-8)17-22(16,18)19/h1-7,17H,(H2,16,18,19) |
| InChIKey | HCMBBXMRRNPAOR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |