C18H19NO4S — CID 146547731
N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]propane-2-sulfonamide (PubChem CID 146547731) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 146547731 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-13(2)24(20,21)19-16-8-5-14(6-9-16)3-4-15-7-10-17-18(11-15)23-12-22-17/h3-11,13,19H,12H2,1-2H3/b4-3+ |
| InChIKey | ATQSEDRLXLDBLC-ONEGZZNKSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|