C14H23NO — CID 134946469
5,7-dimethyl-10-methylidene-12-azatricyclo[6.3.1.04,12]dodecan-6-ol (PubChem CID 134946469) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5,7-dimethyl-10-methylidene-12-azatricyclo[6.3.1.04,12]dodecan-6-ol.
| Compound Name | 5,7-dimethyl-10-methylidene-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
|---|---|
| PubChem CID | 134946469 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5,7-dimethyl-10-methylidene-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
| SMILES | C=C1CC2CCC3C(C)C(O)C(C)C(C1)N23 |
| InChI | InChI=1S/C14H23NO/c1-8-6-11-4-5-12-9(2)14(16)10(3)13(7-8)15(11)12/h9-14,16H,1,4-7H2,2-3H3 |
| InChIKey | PAXUKDQOPOILGE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|