C17H31NOSi — CID 71473171
(1R,4R,5R,6S,7R,8R)-5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol (PubChem CID 71473171) has the molecular formula C17H31NOSi and a molecular weight of 293.53 g/mol. Its IUPAC name is (1R,4R,5R,6S,7R,8R)-5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol.
| Compound Name | (1R,4R,5R,6S,7R,8R)-5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
|---|---|
| PubChem CID | 71473171 |
| Molecular Formula | C17H31NOSi |
| Molecular Weight | 293.53 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (1R,4R,5R,6S,7R,8R)-5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
| SMILES | C=C1C[C@H]2CC[C@@H]3[C@@H](C)[C@H](O)[C@H](C[Si](C)(C)C)[C@@H](C1)N23 |
| InChI | InChI=1S/C17H31NOSi/c1-11-8-13-6-7-15-12(2)17(19)14(10-20(3,4)5)16(9-11)18(13)15/h12-17,19H,1,6-10H2,2-5H3/t12-,13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | MNCOWALJJMGQQC-KWRZAIAESA-N |
| XLogP | 3.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|