About 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol
5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol (PubChem CID 78079576) has the molecular formula C17H31NOSi
and a molecular weight of 293.53 g/mol. Its IUPAC name is 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol.
Molecular Properties
| Compound Name | 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
| PubChem CID | 78079576 |
| Molecular Formula | C17H31NOSi |
| Molecular Weight | 293.53 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol |
| SMILES | C=C1CC2CCC3C(C)C(O)C(C[Si](C)(C)C)C(C1)N23 |
| InChI | InChI=1S/C17H31NOSi/c1-11-8-13-6-7-15-12(2)17(19)14(10-20(3,4)5)16(9-11)18(13)15/h12-17,19H,1,6-10H2,2-5H3 |
| InChIKey | MNCOWALJJMGQQC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol?
The IUPAC name of 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol (CID 78079576) is 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol.
What is the SMILES notation for 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol?
The canonical SMILES for 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol is C=C1CC2CCC3C(C)C(O)C(C[Si](C)(C)C)C(C1)N23.
What is the InChIKey of 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol?
The InChIKey is MNCOWALJJMGQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NOSi/c1-11-8-13-6-7-15-12(2)17(19)14(10-20(3,4)5)16(9-11)18(13)15/h12-17,19H,1,6-10H2,2-5H3.
What are the key properties of 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol?
5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol has a molecular weight of 293.53 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-10-methylidene-7-(trimethylsilylmethyl)-12-azatricyclo[6.3.1.04,12]dodecan-6-ol is sourced from PubChem (CID 78079576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).