C15H15NO2 — CID 134946496
N-[3-(hydroxymethyl)penta-1,4-dien-3-yl]-3-phenylprop-2-ynamide (PubChem CID 134946496) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)penta-1,4-dien-3-yl]-3-phenylprop-2-ynamide.
| Compound Name | N-[3-(hydroxymethyl)penta-1,4-dien-3-yl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 134946496 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[3-(hydroxymethyl)penta-1,4-dien-3-yl]-3-phenylprop-2-ynamide |
| SMILES | C=CC(C=C)(CO)NC(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c1-3-15(4-2,12-17)16-14(18)11-10-13-8-6-5-7-9-13/h3-9,17H,1-2,12H2,(H,16,18) |
| InChIKey | IAQDDPOIWBRDIZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|