C22H36O7Si — CID 134946595
methyl 2-[(3aR,4R,5aS,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-3,7-dioxo-1,4,5,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-5a-yl]acetate (PubChem CID 134946595) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,5aS,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-3,7-dioxo-1,4,5,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-5a-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,5aS,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-3,7-dioxo-1,4,5,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-5a-yl]acetate |
|---|---|
| PubChem CID | 134946595 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl 2-[(3aR,4R,5aS,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-3,7-dioxo-1,4,5,6,8,8a-hexahydrocyclopenta[e][2]benzofuran-5a-yl]acetate |
| SMILES | COC(=O)C[C@@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]3(O)C(=O)OC[C@@]3(C)C1CC(=O)[C@@H]2C |
| InChI | InChI=1S/C22H36O7Si/c1-13-14(23)9-15-20(5)12-28-18(25)22(20,26)16(29-30(7,8)19(2,3)4)10-21(13,15)11-17(24)27-6/h13,15-16,26H,9-12H2,1-8H3/t13-,15?,16+,20-,21+,22+/m0/s1 |
| InChIKey | IUNKKQOXECBYKJ-WFYJEMOPSA-N |
| XLogP | 2.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|